C25H24F6N6 — CID 172958112
3-[3-methyl-5-(trifluoromethyl)-3,4-dihydropyrazol-2-yl]benzonitrile;prop-1-ene;3-[(2E)-2-(1,1,1-trifluoropropan-2-ylidene)hydrazinyl]benzonitrile (PubChem CID 172958112) has the molecular formula C25H24F6N6 and a molecular weight of 522.50 g/mol. Its IUPAC name is 3-[3-methyl-5-(trifluoromethyl)-3,4-dihydropyrazol-2-yl]benzonitrile;prop-1-ene;3-[(2E)-2-(1,1,1-trifluoropropan-2-ylidene)hydrazinyl]benzonitrile.
| Compound Name | 3-[3-methyl-5-(trifluoromethyl)-3,4-dihydropyrazol-2-yl]benzonitrile;prop-1-ene;3-[(2E)-2-(1,1,1-trifluoropropan-2-ylidene)hydrazinyl]benzonitrile |
|---|---|
| PubChem CID | 172958112 |
| Molecular Formula | C25H24F6N6 |
| Molecular Weight | 522.50 g/mol |
| Exact Mass | 522.20 |
| IUPAC Name | 3-[3-methyl-5-(trifluoromethyl)-3,4-dihydropyrazol-2-yl]benzonitrile;prop-1-ene;3-[(2E)-2-(1,1,1-trifluoropropan-2-ylidene)hydrazinyl]benzonitrile |
| SMILES | C/C(=N\Nc1cccc(C#N)c1)C(F)(F)F.C=CC.CC1CC(C(F)(F)F)=NN1c1cccc(C#N)c1 |
| InChI | InChI=1S/C12H10F3N3.C10H8F3N3.C3H6/c1-8-5-11(12(13,14)15)17-18(8)10-4-2-3-9(6-10)7-16;1-7(10(11,12)13)15-16-9-4-2-3-8(5-9)6-14;1-3-2/h2-4,6,8H,5H2,1H3;2-5,16H,1H3;3H,1H2,2H3/b;15-7+; |
| InChIKey | DWFAHTJAIFPDHD-OMLYNKHZSA-N |
| XLogP | 7.18 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.50 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|