C28H20F9N9O5S — CID 172917553
bis(N'-(3-cyanophenyl)-2,2,2-trifluoroacetohydrazide);methylsulfonyl (1Z)-N-(3-cyanophenyl)-2,2,2-trifluoroethanehydrazonate (PubChem CID 172917553) has the molecular formula C28H20F9N9O5S and a molecular weight of 765.57 g/mol. Its IUPAC name is bis(N'-(3-cyanophenyl)-2,2,2-trifluoroacetohydrazide);methylsulfonyl (1Z)-N-(3-cyanophenyl)-2,2,2-trifluoroethanehydrazonate.
| Compound Name | bis(N'-(3-cyanophenyl)-2,2,2-trifluoroacetohydrazide);methylsulfonyl (1Z)-N-(3-cyanophenyl)-2,2,2-trifluoroethanehydrazonate |
|---|---|
| PubChem CID | 172917553 |
| Molecular Formula | C28H20F9N9O5S |
| Molecular Weight | 765.57 g/mol |
| Exact Mass | 765.12 |
| IUPAC Name | bis(N'-(3-cyanophenyl)-2,2,2-trifluoroacetohydrazide);methylsulfonyl (1Z)-N-(3-cyanophenyl)-2,2,2-trifluoroethanehydrazonate |
| SMILES | CS(=O)(=O)O/C(=N\Nc1cccc(C#N)c1)C(F)(F)F.N#Cc1cccc(NNC(=O)C(F)(F)F)c1.N#Cc1cccc(NNC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C10H8F3N3O3S.2C9H6F3N3O/c1-20(17,18)19-9(10(11,12)13)16-15-8-4-2-3-7(5-8)6-14;2*10-9(11,12)8(16)15-14-7-3-1-2-6(4-7)5-13/h2-5,15H,1H3;2*1-4,14H,(H,15,16)/b16-9-;; |
| InChIKey | IQOXFTMECNHKEP-ULPVBNQHSA-N |
| XLogP | 4.95 |
| TPSA | 221.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.57 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|