C12H16N2O3S — CID 94695849
N-(3-cyanophenyl)-3-hydroxy-2,2-dimethylpropane-1-sulfonamide (PubChem CID 94695849) has the molecular formula C12H16N2O3S and a molecular weight of 268.34 g/mol. Its IUPAC name is N-(3-cyanophenyl)-3-hydroxy-2,2-dimethylpropane-1-sulfonamide.
| Compound Name | N-(3-cyanophenyl)-3-hydroxy-2,2-dimethylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 94695849 |
| Molecular Formula | C12H16N2O3S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | N-(3-cyanophenyl)-3-hydroxy-2,2-dimethylpropane-1-sulfonamide |
| SMILES | CC(C)(CO)CS(=O)(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C12H16N2O3S/c1-12(2,8-15)9-18(16,17)14-11-5-3-4-10(6-11)7-13/h3-6,14-15H,8-9H2,1-2H3 |
| InChIKey | HQCWAVUIACLYCY-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |