C8H6F2N2O2S — CID 28607007
N-(3-cyanophenyl)-1,1-difluoromethanesulfonamide (PubChem CID 28607007) has the molecular formula C8H6F2N2O2S and a molecular weight of 232.21 g/mol. Its IUPAC name is N-(3-cyanophenyl)-1,1-difluoromethanesulfonamide.
| Compound Name | N-(3-cyanophenyl)-1,1-difluoromethanesulfonamide |
|---|---|
| PubChem CID | 28607007 |
| Molecular Formula | C8H6F2N2O2S |
| Molecular Weight | 232.21 g/mol |
| Exact Mass | 232.01 |
| IUPAC Name | N-(3-cyanophenyl)-1,1-difluoromethanesulfonamide |
| SMILES | N#Cc1cccc(NS(=O)(=O)C(F)F)c1 |
| InChI | InChI=1S/C8H6F2N2O2S/c9-8(10)15(13,14)12-7-3-1-2-6(4-7)5-11/h1-4,8,12H |
| InChIKey | KWMKZNZEWRMROM-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.21 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |