C8H5ClF2N2O2S — CID 107808248
N-(2-chloro-4-cyanophenyl)-1,1-difluoromethanesulfonamide (PubChem CID 107808248) has the molecular formula C8H5ClF2N2O2S and a molecular weight of 266.66 g/mol. Its IUPAC name is N-(2-chloro-4-cyanophenyl)-1,1-difluoromethanesulfonamide.
| Compound Name | N-(2-chloro-4-cyanophenyl)-1,1-difluoromethanesulfonamide |
|---|---|
| PubChem CID | 107808248 |
| Molecular Formula | C8H5ClF2N2O2S |
| Molecular Weight | 266.66 g/mol |
| Exact Mass | 265.97 |
| IUPAC Name | N-(2-chloro-4-cyanophenyl)-1,1-difluoromethanesulfonamide |
| SMILES | N#Cc1ccc(NS(=O)(=O)C(F)F)c(Cl)c1 |
| InChI | InChI=1S/C8H5ClF2N2O2S/c9-6-3-5(4-12)1-2-7(6)13-16(14,15)8(10)11/h1-3,8,13H |
| InChIKey | ABFHWOXFTNFSFO-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.66 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |