C8H7F2N3O2S — CID 43550801
N-(4-amino-2-cyanophenyl)-1,1-difluoromethanesulfonamide (PubChem CID 43550801) has the molecular formula C8H7F2N3O2S and a molecular weight of 247.23 g/mol. Its IUPAC name is N-(4-amino-2-cyanophenyl)-1,1-difluoromethanesulfonamide.
| Compound Name | N-(4-amino-2-cyanophenyl)-1,1-difluoromethanesulfonamide |
|---|---|
| PubChem CID | 43550801 |
| Molecular Formula | C8H7F2N3O2S |
| Molecular Weight | 247.23 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | N-(4-amino-2-cyanophenyl)-1,1-difluoromethanesulfonamide |
| SMILES | N#Cc1cc(N)ccc1NS(=O)(=O)C(F)F |
| InChI | InChI=1S/C8H7F2N3O2S/c9-8(10)16(14,15)13-7-2-1-6(12)3-5(7)4-11/h1-3,8,13H,12H2 |
| InChIKey | MITIXMLOEXGPSN-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.23 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|