C11H10ClF3N2O2S — CID 103580529
N-(2-chloro-4-cyanophenyl)-4,4,4-trifluorobutane-1-sulfonamide (PubChem CID 103580529) has the molecular formula C11H10ClF3N2O2S and a molecular weight of 326.73 g/mol. Its IUPAC name is N-(2-chloro-4-cyanophenyl)-4,4,4-trifluorobutane-1-sulfonamide.
| Compound Name | N-(2-chloro-4-cyanophenyl)-4,4,4-trifluorobutane-1-sulfonamide |
|---|---|
| PubChem CID | 103580529 |
| Molecular Formula | C11H10ClF3N2O2S |
| Molecular Weight | 326.73 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | N-(2-chloro-4-cyanophenyl)-4,4,4-trifluorobutane-1-sulfonamide |
| SMILES | N#Cc1ccc(NS(=O)(=O)CCCC(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C11H10ClF3N2O2S/c12-9-6-8(7-16)2-3-10(9)17-20(18,19)5-1-4-11(13,14)15/h2-3,6,17H,1,4-5H2 |
| InChIKey | LTZWFWMFILOCHP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.73 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |