C9H10ClF3N2O2S — CID 103943751
N-(2-chloro-3-pyridinyl)-4,4,4-trifluorobutane-1-sulfonamide (PubChem CID 103943751) has the molecular formula C9H10ClF3N2O2S and a molecular weight of 302.71 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-4,4,4-trifluorobutane-1-sulfonamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-4,4,4-trifluorobutane-1-sulfonamide |
|---|---|
| PubChem CID | 103943751 |
| Molecular Formula | C9H10ClF3N2O2S |
| Molecular Weight | 302.71 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-4,4,4-trifluorobutane-1-sulfonamide |
| SMILES | O=S(=O)(CCCC(F)(F)F)Nc1cccnc1Cl |
| InChI | InChI=1S/C9H10ClF3N2O2S/c10-8-7(3-1-5-14-8)15-18(16,17)6-2-4-9(11,12)13/h1,3,5,15H,2,4,6H2 |
| InChIKey | RNHQVEZJVKGKSI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.71 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|