C7H10F3N3O2S — CID 83057926
4,4,4-trifluoro-N-(1H-pyrazol-5-yl)butane-1-sulfonamide (PubChem CID 83057926) has the molecular formula C7H10F3N3O2S and a molecular weight of 257.24 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-(1H-pyrazol-5-yl)butane-1-sulfonamide.
| Compound Name | 4,4,4-trifluoro-N-(1H-pyrazol-5-yl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 83057926 |
| Molecular Formula | C7H10F3N3O2S |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 4,4,4-trifluoro-N-(1H-pyrazol-5-yl)butane-1-sulfonamide |
| SMILES | O=S(=O)(CCCC(F)(F)F)Nc1ccn[nH]1 |
| InChI | InChI=1S/C7H10F3N3O2S/c8-7(9,10)3-1-5-16(14,15)13-6-2-4-11-12-6/h2,4H,1,3,5H2,(H2,11,12,13) |
| InChIKey | UKFSDZDGCMXLIO-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |