C9H12F3N3O2S — CID 83068756
N-(5-amino-2-pyridinyl)-4,4,4-trifluorobutane-1-sulfonamide (PubChem CID 83068756) has the molecular formula C9H12F3N3O2S and a molecular weight of 283.27 g/mol. Its IUPAC name is N-(5-amino-2-pyridinyl)-4,4,4-trifluorobutane-1-sulfonamide.
| Compound Name | N-(5-amino-2-pyridinyl)-4,4,4-trifluorobutane-1-sulfonamide |
|---|---|
| PubChem CID | 83068756 |
| Molecular Formula | C9H12F3N3O2S |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | N-(5-amino-2-pyridinyl)-4,4,4-trifluorobutane-1-sulfonamide |
| SMILES | Nc1ccc(NS(=O)(=O)CCCC(F)(F)F)nc1 |
| InChI | InChI=1S/C9H12F3N3O2S/c10-9(11,12)4-1-5-18(16,17)15-8-3-2-7(13)6-14-8/h2-3,6H,1,4-5,13H2,(H,14,15) |
| InChIKey | LRICDFUYVZSBBP-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |