C9H9BrClF3N2O2S — CID 112750103
N-(2-bromo-5-chloro-3-pyridinyl)-4,4,4-trifluorobutane-1-sulfonamide (PubChem CID 112750103) has the molecular formula C9H9BrClF3N2O2S and a molecular weight of 381.60 g/mol. Its IUPAC name is N-(2-bromo-5-chloro-3-pyridinyl)-4,4,4-trifluorobutane-1-sulfonamide.
| Compound Name | N-(2-bromo-5-chloro-3-pyridinyl)-4,4,4-trifluorobutane-1-sulfonamide |
|---|---|
| PubChem CID | 112750103 |
| Molecular Formula | C9H9BrClF3N2O2S |
| Molecular Weight | 381.60 g/mol |
| Exact Mass | 379.92 |
| IUPAC Name | N-(2-bromo-5-chloro-3-pyridinyl)-4,4,4-trifluorobutane-1-sulfonamide |
| SMILES | O=S(=O)(CCCC(F)(F)F)Nc1cc(Cl)cnc1Br |
| InChI | InChI=1S/C9H9BrClF3N2O2S/c10-8-7(4-6(11)5-15-8)16-19(17,18)3-1-2-9(12,13)14/h4-5,16H,1-3H2 |
| InChIKey | ITJYAOZDZMIJRY-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.60 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|