2-(4,4,4-trifluorobutylsulfonylamino)benzenesulfonyl fluoride

C10H11F4NO4S2 — CID 116814342

IUPAC2-(4,4,4-trifluorobutylsulfonylamino)benzenesulfonyl fluoride
SMILESO=S(=O)(CCCC(F)(F)F)Nc1ccccc1S(=O)(=O)F
InChIInChI=1S/C10H11F4NO4S2/c11-10(12,13)6-3-7-20(16,17)15-8-4-1-2-5-9(8)21(14,18)19/h1-2,4-5,15H,3,6-7H2
InChIKeyVPEKHTUNJNOQPG-UHFFFAOYSA-N
MW349.33 g/mol
LogP2.43
Rot. Bonds6

About 2-(4,4,4-trifluorobutylsulfonylamino)benzenesulfonyl fluoride

2-(4,4,4-trifluorobutylsulfonylamino)benzenesulfonyl fluoride (PubChem CID 116814342) has the molecular formula C10H11F4NO4S2 and a molecular weight of 349.33 g/mol. Its IUPAC name is 2-(4,4,4-trifluorobutylsulfonylamino)benzenesulfonyl fluoride.

Molecular Properties

Compound Name2-(4,4,4-trifluorobutylsulfonylamino)benzenesulfonyl fluoride
PubChem CID116814342
Molecular FormulaC10H11F4NO4S2
Molecular Weight349.33 g/mol
Exact Mass349.01
IUPAC Name2-(4,4,4-trifluorobutylsulfonylamino)benzenesulfonyl fluoride
SMILESO=S(=O)(CCCC(F)(F)F)Nc1ccccc1S(=O)(=O)F
InChIInChI=1S/C10H11F4NO4S2/c11-10(12,13)6-3-7-20(16,17)15-8-4-1-2-5-9(8)21(14,18)19/h1-2,4-5,15H,3,6-7H2
InChIKeyVPEKHTUNJNOQPG-UHFFFAOYSA-N
XLogP2.43
TPSA80.31 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500349.33
LogP ≤ 52.43
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(4,4,4-trifluorobutylsulfonylamino)benzenesulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4,4,4-trifluorobutylsulfonylamino)benzenesulfonyl fluoride?
The IUPAC name of 2-(4,4,4-trifluorobutylsulfonylamino)benzenesulfonyl fluoride (CID 116814342) is 2-(4,4,4-trifluorobutylsulfonylamino)benzenesulfonyl fluoride.
What is the SMILES notation for 2-(4,4,4-trifluorobutylsulfonylamino)benzenesulfonyl fluoride?
The canonical SMILES for 2-(4,4,4-trifluorobutylsulfonylamino)benzenesulfonyl fluoride is O=S(=O)(CCCC(F)(F)F)Nc1ccccc1S(=O)(=O)F.
What is the InChIKey of 2-(4,4,4-trifluorobutylsulfonylamino)benzenesulfonyl fluoride?
The InChIKey is VPEKHTUNJNOQPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F4NO4S2/c11-10(12,13)6-3-7-20(16,17)15-8-4-1-2-5-9(8)21(14,18)19/h1-2,4-5,15H,3,6-7H2.
What are the key properties of 2-(4,4,4-trifluorobutylsulfonylamino)benzenesulfonyl fluoride?
2-(4,4,4-trifluorobutylsulfonylamino)benzenesulfonyl fluoride has a molecular weight of 349.33 g/mol, XLogP of 2.43, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4,4-trifluorobutylsulfonylamino)benzenesulfonyl fluoride is sourced from PubChem (CID 116814342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).