C10H11F4NO4S2 — CID 116814342
2-(4,4,4-trifluorobutylsulfonylamino)benzenesulfonyl fluoride (PubChem CID 116814342) has the molecular formula C10H11F4NO4S2 and a molecular weight of 349.33 g/mol. Its IUPAC name is 2-(4,4,4-trifluorobutylsulfonylamino)benzenesulfonyl fluoride.
| Compound Name | 2-(4,4,4-trifluorobutylsulfonylamino)benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 116814342 |
| Molecular Formula | C10H11F4NO4S2 |
| Molecular Weight | 349.33 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | 2-(4,4,4-trifluorobutylsulfonylamino)benzenesulfonyl fluoride |
| SMILES | O=S(=O)(CCCC(F)(F)F)Nc1ccccc1S(=O)(=O)F |
| InChI | InChI=1S/C10H11F4NO4S2/c11-10(12,13)6-3-7-20(16,17)15-8-4-1-2-5-9(8)21(14,18)19/h1-2,4-5,15H,3,6-7H2 |
| InChIKey | VPEKHTUNJNOQPG-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |