C10H11BrF3NO3S — CID 83059561
N-(5-bromo-2-hydroxyphenyl)-4,4,4-trifluorobutane-1-sulfonamide (PubChem CID 83059561) has the molecular formula C10H11BrF3NO3S and a molecular weight of 362.17 g/mol. Its IUPAC name is N-(5-bromo-2-hydroxyphenyl)-4,4,4-trifluorobutane-1-sulfonamide.
| Compound Name | N-(5-bromo-2-hydroxyphenyl)-4,4,4-trifluorobutane-1-sulfonamide |
|---|---|
| PubChem CID | 83059561 |
| Molecular Formula | C10H11BrF3NO3S |
| Molecular Weight | 362.17 g/mol |
| Exact Mass | 360.96 |
| IUPAC Name | N-(5-bromo-2-hydroxyphenyl)-4,4,4-trifluorobutane-1-sulfonamide |
| SMILES | O=S(=O)(CCCC(F)(F)F)Nc1cc(Br)ccc1O |
| InChI | InChI=1S/C10H11BrF3NO3S/c11-7-2-3-9(16)8(6-7)15-19(17,18)5-1-4-10(12,13)14/h2-3,6,15-16H,1,4-5H2 |
| InChIKey | RPDABHNEUKRWFL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.17 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|