C11H16BrNO3S — CID 55171348
N-(5-bromo-2-methylphenyl)-3-methoxypropane-1-sulfonamide (PubChem CID 55171348) has the molecular formula C11H16BrNO3S and a molecular weight of 322.22 g/mol. Its IUPAC name is N-(5-bromo-2-methylphenyl)-3-methoxypropane-1-sulfonamide.
| Compound Name | N-(5-bromo-2-methylphenyl)-3-methoxypropane-1-sulfonamide |
|---|---|
| PubChem CID | 55171348 |
| Molecular Formula | C11H16BrNO3S |
| Molecular Weight | 322.22 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | N-(5-bromo-2-methylphenyl)-3-methoxypropane-1-sulfonamide |
| SMILES | COCCCS(=O)(=O)Nc1cc(Br)ccc1C |
| InChI | InChI=1S/C11H16BrNO3S/c1-9-4-5-10(12)8-11(9)13-17(14,15)7-3-6-16-2/h4-5,8,13H,3,6-7H2,1-2H3 |
| InChIKey | JLXGTUOYYVSTEW-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.22 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|