C13H12F6N4 — CID 88569174
3-[2-[1-[(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)amino]ethenyl]hydrazinyl]benzonitrile (PubChem CID 88569174) has the molecular formula C13H12F6N4 and a molecular weight of 338.26 g/mol. Its IUPAC name is 3-[2-[1-[(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)amino]ethenyl]hydrazinyl]benzonitrile.
| Compound Name | 3-[2-[1-[(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)amino]ethenyl]hydrazinyl]benzonitrile |
|---|---|
| PubChem CID | 88569174 |
| Molecular Formula | C13H12F6N4 |
| Molecular Weight | 338.26 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 3-[2-[1-[(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)amino]ethenyl]hydrazinyl]benzonitrile |
| SMILES | C=C(NNc1cccc(C#N)c1)NC(C)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H12F6N4/c1-8(21-11(2,12(14,15)16)13(17,18)19)22-23-10-5-3-4-9(6-10)7-20/h3-6,21-23H,1H2,2H3 |
| InChIKey | OCAGJCNTDHJHOB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 59.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.26 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|