C12H12ClF6N3 — CID 88569191
N-[1-[2-(2-chlorophenyl)hydrazinyl]ethenyl]-1,1,1,3,3,3-hexafluoro-2-methylpropan-2-amine (PubChem CID 88569191) has the molecular formula C12H12ClF6N3 and a molecular weight of 347.69 g/mol. Its IUPAC name is N-[1-[2-(2-chlorophenyl)hydrazinyl]ethenyl]-1,1,1,3,3,3-hexafluoro-2-methylpropan-2-amine.
| Compound Name | N-[1-[2-(2-chlorophenyl)hydrazinyl]ethenyl]-1,1,1,3,3,3-hexafluoro-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 88569191 |
| Molecular Formula | C12H12ClF6N3 |
| Molecular Weight | 347.69 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | N-[1-[2-(2-chlorophenyl)hydrazinyl]ethenyl]-1,1,1,3,3,3-hexafluoro-2-methylpropan-2-amine |
| SMILES | C=C(NNc1ccccc1Cl)NC(C)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H12ClF6N3/c1-7(21-22-9-6-4-3-5-8(9)13)20-10(2,11(14,15)16)12(17,18)19/h3-6,20-22H,1H2,2H3 |
| InChIKey | JKALZLDGWJPLQP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.69 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|