About 2-chloro-N-methylaniline;ethene
2-chloro-N-methylaniline;ethene (PubChem CID 142416453) has the molecular formula C9H12ClN
and a molecular weight of 169.65 g/mol. Its IUPAC name is 2-chloro-N-methylaniline;ethene.
Molecular Properties
| Compound Name | 2-chloro-N-methylaniline;ethene |
| PubChem CID | 142416453 |
| Molecular Formula | C9H12ClN |
| Molecular Weight | 169.65 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 2-chloro-N-methylaniline;ethene |
| SMILES | C=C.CNc1ccccc1Cl |
| InChI | InChI=1S/C7H8ClN.C2H4/c1-9-7-5-3-2-4-6(7)8;1-2/h2-5,9H,1H3;1-2H2 |
| InChIKey | ZIRAAWJIDFYWBC-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.65 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-methylaniline;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-methylaniline;ethene?
The IUPAC name of 2-chloro-N-methylaniline;ethene (CID 142416453) is 2-chloro-N-methylaniline;ethene.
What is the SMILES notation for 2-chloro-N-methylaniline;ethene?
The canonical SMILES for 2-chloro-N-methylaniline;ethene is C=C.CNc1ccccc1Cl.
What is the InChIKey of 2-chloro-N-methylaniline;ethene?
The InChIKey is ZIRAAWJIDFYWBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8ClN.C2H4/c1-9-7-5-3-2-4-6(7)8;1-2/h2-5,9H,1H3;1-2H2.
What are the key properties of 2-chloro-N-methylaniline;ethene?
2-chloro-N-methylaniline;ethene has a molecular weight of 169.65 g/mol, XLogP of 3.18, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-methylaniline;ethene is sourced from PubChem (CID 142416453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).