About (2-chloroanilino)azanium
(2-chloroanilino)azanium (PubChem CID 3859073) has the molecular formula C6H8ClN2+
and a molecular weight of 143.60 g/mol. Its IUPAC name is (2-chloroanilino)azanium.
Molecular Properties
| Compound Name | (2-chloroanilino)azanium |
| PubChem CID | 3859073 |
| Molecular Formula | C6H8ClN2+ |
| Molecular Weight | 143.60 g/mol |
| Exact Mass | 143.04 |
| IUPAC Name | (2-chloroanilino)azanium |
| SMILES | [NH3+]Nc1ccccc1Cl |
| InChI | InChI=1S/C6H7ClN2/c7-5-3-1-2-4-6(5)9-8/h1-4,9H,8H2/p+1 |
| InChIKey | GHGPIPTUDQZJJS-UHFFFAOYSA-O |
| XLogP | 0.91 |
| TPSA | 39.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.60 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-chloroanilino)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloroanilino)azanium?
The IUPAC name of (2-chloroanilino)azanium (CID 3859073) is (2-chloroanilino)azanium.
What is the SMILES notation for (2-chloroanilino)azanium?
The canonical SMILES for (2-chloroanilino)azanium is [NH3+]Nc1ccccc1Cl.
What is the InChIKey of (2-chloroanilino)azanium?
The InChIKey is GHGPIPTUDQZJJS-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H7ClN2/c7-5-3-1-2-4-6(5)9-8/h1-4,9H,8H2/p+1.
What are the key properties of (2-chloroanilino)azanium?
(2-chloroanilino)azanium has a molecular weight of 143.60 g/mol, XLogP of 0.91, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloroanilino)azanium is sourced from PubChem (CID 3859073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).