C6H7Cl2N2+ — CID 3613968
(2,6-dichloroanilino)azanium (PubChem CID 3613968) has the molecular formula C6H7Cl2N2+ and a molecular weight of 178.04 g/mol. Its IUPAC name is (2,6-dichloroanilino)azanium.
| Compound Name | (2,6-dichloroanilino)azanium |
|---|---|
| PubChem CID | 3613968 |
| Molecular Formula | C6H7Cl2N2+ |
| Molecular Weight | 178.04 g/mol |
| Exact Mass | 177.00 |
| IUPAC Name | (2,6-dichloroanilino)azanium |
| SMILES | [NH3+]Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C6H6Cl2N2/c7-4-2-1-3-5(8)6(4)10-9/h1-3,10H,9H2/p+1 |
| InChIKey | IDTWYHVEGJBGPT-UHFFFAOYSA-O |
| XLogP | 1.56 |
| TPSA | 39.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.04 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|