C8H7Cl2NO — CID 155192832
2-(2,6-dichloroanilino)acetaldehyde (PubChem CID 155192832) has the molecular formula C8H7Cl2NO and a molecular weight of 204.06 g/mol. Its IUPAC name is 2-(2,6-dichloroanilino)acetaldehyde.
| Compound Name | 2-(2,6-dichloroanilino)acetaldehyde |
|---|---|
| PubChem CID | 155192832 |
| Molecular Formula | C8H7Cl2NO |
| Molecular Weight | 204.06 g/mol |
| Exact Mass | 202.99 |
| IUPAC Name | 2-(2,6-dichloroanilino)acetaldehyde |
| SMILES | O=CCNc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C8H7Cl2NO/c9-6-2-1-3-7(10)8(6)11-4-5-12/h1-3,5,11H,4H2 |
| InChIKey | DSWRISRBGMGNDI-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.06 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|