C15H16Cl2N2 — CID 22450713
N,N'-bis(2-chloro-6-methylphenyl)methanediamine (PubChem CID 22450713) has the molecular formula C15H16Cl2N2 and a molecular weight of 295.21 g/mol. Its IUPAC name is N,N'-bis(2-chloro-6-methylphenyl)methanediamine.
| Compound Name | N,N'-bis(2-chloro-6-methylphenyl)methanediamine |
|---|---|
| PubChem CID | 22450713 |
| Molecular Formula | C15H16Cl2N2 |
| Molecular Weight | 295.21 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | N,N'-bis(2-chloro-6-methylphenyl)methanediamine |
| SMILES | Cc1cccc(Cl)c1NCNc1c(C)cccc1Cl |
| InChI | InChI=1S/C15H16Cl2N2/c1-10-5-3-7-12(16)14(10)18-9-19-15-11(2)6-4-8-13(15)17/h3-8,18-19H,9H2,1-2H3 |
| InChIKey | LQILOZPMRKASFP-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.21 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|