C9H10ClF2N — CID 66251946
2-chloro-N-(2,2-difluoroethyl)-6-methylaniline (PubChem CID 66251946) has the molecular formula C9H10ClF2N and a molecular weight of 205.64 g/mol. Its IUPAC name is 2-chloro-N-(2,2-difluoroethyl)-6-methylaniline.
| Compound Name | 2-chloro-N-(2,2-difluoroethyl)-6-methylaniline |
|---|---|
| PubChem CID | 66251946 |
| Molecular Formula | C9H10ClF2N |
| Molecular Weight | 205.64 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | 2-chloro-N-(2,2-difluoroethyl)-6-methylaniline |
| SMILES | Cc1cccc(Cl)c1NCC(F)F |
| InChI | InChI=1S/C9H10ClF2N/c1-6-3-2-4-7(10)9(6)13-5-8(11)12/h2-4,8,13H,5H2,1H3 |
| InChIKey | NEFYNGLVKRDHAB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.64 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |