About 3-chloro-2-N-(2,2-difluoroethyl)benzene-1,2-diamine
3-chloro-2-N-(2,2-difluoroethyl)benzene-1,2-diamine (PubChem CID 115405373) has the molecular formula C8H9ClF2N2
and a molecular weight of 206.62 g/mol. Its IUPAC name is 3-chloro-2-N-(2,2-difluoroethyl)benzene-1,2-diamine.
Molecular Properties
| Compound Name | 3-chloro-2-N-(2,2-difluoroethyl)benzene-1,2-diamine |
| PubChem CID | 115405373 |
| Molecular Formula | C8H9ClF2N2 |
| Molecular Weight | 206.62 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | 3-chloro-2-N-(2,2-difluoroethyl)benzene-1,2-diamine |
| SMILES | Nc1cccc(Cl)c1NCC(F)F |
| InChI | InChI=1S/C8H9ClF2N2/c9-5-2-1-3-6(12)8(5)13-4-7(10)11/h1-3,7,13H,4,12H2 |
| InChIKey | FCZGONANTXIONB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.62 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-2-N-(2,2-difluoroethyl)benzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2-N-(2,2-difluoroethyl)benzene-1,2-diamine?
The IUPAC name of 3-chloro-2-N-(2,2-difluoroethyl)benzene-1,2-diamine (CID 115405373) is 3-chloro-2-N-(2,2-difluoroethyl)benzene-1,2-diamine.
What is the SMILES notation for 3-chloro-2-N-(2,2-difluoroethyl)benzene-1,2-diamine?
The canonical SMILES for 3-chloro-2-N-(2,2-difluoroethyl)benzene-1,2-diamine is Nc1cccc(Cl)c1NCC(F)F.
What is the InChIKey of 3-chloro-2-N-(2,2-difluoroethyl)benzene-1,2-diamine?
The InChIKey is FCZGONANTXIONB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClF2N2/c9-5-2-1-3-6(12)8(5)13-4-7(10)11/h1-3,7,13H,4,12H2.
What are the key properties of 3-chloro-2-N-(2,2-difluoroethyl)benzene-1,2-diamine?
3-chloro-2-N-(2,2-difluoroethyl)benzene-1,2-diamine has a molecular weight of 206.62 g/mol, XLogP of 2.60, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2-N-(2,2-difluoroethyl)benzene-1,2-diamine is sourced from PubChem (CID 115405373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).