C8H6Cl3F2N — CID 60922157
2,4,6-trichloro-N-(2,2-difluoroethyl)aniline (PubChem CID 60922157) has the molecular formula C8H6Cl3F2N and a molecular weight of 260.50 g/mol. Its IUPAC name is 2,4,6-trichloro-N-(2,2-difluoroethyl)aniline.
| Compound Name | 2,4,6-trichloro-N-(2,2-difluoroethyl)aniline |
|---|---|
| PubChem CID | 60922157 |
| Molecular Formula | C8H6Cl3F2N |
| Molecular Weight | 260.50 g/mol |
| Exact Mass | 258.95 |
| IUPAC Name | 2,4,6-trichloro-N-(2,2-difluoroethyl)aniline |
| SMILES | FC(F)CNc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C8H6Cl3F2N/c9-4-1-5(10)8(6(11)2-4)14-3-7(12)13/h1-2,7,14H,3H2 |
| InChIKey | BCOSFKNPKMZTRF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.50 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |