C12H9ClF2N2O2 — CID 134334099
3-(2-chloroanilino)-4-(2,2-difluoroethylamino)cyclobut-3-ene-1,2-dione (PubChem CID 134334099) has the molecular formula C12H9ClF2N2O2 and a molecular weight of 286.66 g/mol. Its IUPAC name is 3-(2-chloroanilino)-4-(2,2-difluoroethylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(2-chloroanilino)-4-(2,2-difluoroethylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 134334099 |
| Molecular Formula | C12H9ClF2N2O2 |
| Molecular Weight | 286.66 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 3-(2-chloroanilino)-4-(2,2-difluoroethylamino)cyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(NCC(F)F)c(Nc2ccccc2Cl)c1=O |
| InChI | InChI=1S/C12H9ClF2N2O2/c13-6-3-1-2-4-7(6)17-10-9(11(18)12(10)19)16-5-8(14)15/h1-4,8,16-17H,5H2 |
| InChIKey | OWWZGJMMSCGCFX-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.66 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|