C12H16Cl3NO2 — CID 81093868
2,4,6-trichloro-N-(2,2-diethoxyethyl)aniline (PubChem CID 81093868) has the molecular formula C12H16Cl3NO2 and a molecular weight of 312.62 g/mol. Its IUPAC name is 2,4,6-trichloro-N-(2,2-diethoxyethyl)aniline.
| Compound Name | 2,4,6-trichloro-N-(2,2-diethoxyethyl)aniline |
|---|---|
| PubChem CID | 81093868 |
| Molecular Formula | C12H16Cl3NO2 |
| Molecular Weight | 312.62 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | 2,4,6-trichloro-N-(2,2-diethoxyethyl)aniline |
| SMILES | CCOC(CNc1c(Cl)cc(Cl)cc1Cl)OCC |
| InChI | InChI=1S/C12H16Cl3NO2/c1-3-17-11(18-4-2)7-16-12-9(14)5-8(13)6-10(12)15/h5-6,11,16H,3-4,7H2,1-2H3 |
| InChIKey | ILAPKTWWANLVQJ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.62 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|