C12H17Cl2NO2 — CID 81093226
2,4-dichloro-N-(2,2-diethoxyethyl)aniline (PubChem CID 81093226) has the molecular formula C12H17Cl2NO2 and a molecular weight of 278.18 g/mol. Its IUPAC name is 2,4-dichloro-N-(2,2-diethoxyethyl)aniline.
| Compound Name | 2,4-dichloro-N-(2,2-diethoxyethyl)aniline |
|---|---|
| PubChem CID | 81093226 |
| Molecular Formula | C12H17Cl2NO2 |
| Molecular Weight | 278.18 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 2,4-dichloro-N-(2,2-diethoxyethyl)aniline |
| SMILES | CCOC(CNc1ccc(Cl)cc1Cl)OCC |
| InChI | InChI=1S/C12H17Cl2NO2/c1-3-16-12(17-4-2)8-15-11-6-5-9(13)7-10(11)14/h5-7,12,15H,3-4,8H2,1-2H3 |
| InChIKey | SBDCJZUSFKQBKP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.18 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|