C13H18Cl2N2O3 — CID 3301738
1-(2,4-dichlorophenyl)-3-(2,2-diethoxyethyl)urea (PubChem CID 3301738) has the molecular formula C13H18Cl2N2O3 and a molecular weight of 321.20 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-(2,2-diethoxyethyl)urea.
| Compound Name | 1-(2,4-dichlorophenyl)-3-(2,2-diethoxyethyl)urea |
|---|---|
| PubChem CID | 3301738 |
| Molecular Formula | C13H18Cl2N2O3 |
| Molecular Weight | 321.20 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-(2,2-diethoxyethyl)urea |
| SMILES | CCOC(CNC(=O)Nc1ccc(Cl)cc1Cl)OCC |
| InChI | InChI=1S/C13H18Cl2N2O3/c1-3-19-12(20-4-2)8-16-13(18)17-11-6-5-9(14)7-10(11)15/h5-7,12H,3-4,8H2,1-2H3,(H2,16,17,18) |
| InChIKey | QSEHQBAVGRACMP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.20 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|