C15H21Cl2N3O2 — CID 51944280
1-(2,4-dichlorophenyl)-3-[(2R)-2-hydroxy-3-piperidin-1-ylpropyl]urea (PubChem CID 51944280) has the molecular formula C15H21Cl2N3O2 and a molecular weight of 346.26 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-[(2R)-2-hydroxy-3-piperidin-1-ylpropyl]urea.
| Compound Name | 1-(2,4-dichlorophenyl)-3-[(2R)-2-hydroxy-3-piperidin-1-ylpropyl]urea |
|---|---|
| PubChem CID | 51944280 |
| Molecular Formula | C15H21Cl2N3O2 |
| Molecular Weight | 346.26 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-[(2R)-2-hydroxy-3-piperidin-1-ylpropyl]urea |
| SMILES | O=C(NC[C@@H](O)CN1CCCCC1)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H21Cl2N3O2/c16-11-4-5-14(13(17)8-11)19-15(22)18-9-12(21)10-20-6-2-1-3-7-20/h4-5,8,12,21H,1-3,6-7,9-10H2,(H2,18,19,22)/t12-/m1/s1 |
| InChIKey | MLGORHJFTYYGSE-GFCCVEGCSA-N |
| XLogP | 2.96 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.26 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |