C18H28N4O3 — CID 125176210
N-[3-[[(2R)-2-hydroxy-3-pyrrolidin-1-ylpropyl]carbamoylamino]-4-methylphenyl]propanamide (PubChem CID 125176210) has the molecular formula C18H28N4O3 and a molecular weight of 348.45 g/mol. Its IUPAC name is N-[3-[[(2R)-2-hydroxy-3-pyrrolidin-1-ylpropyl]carbamoylamino]-4-methylphenyl]propanamide.
| Compound Name | N-[3-[[(2R)-2-hydroxy-3-pyrrolidin-1-ylpropyl]carbamoylamino]-4-methylphenyl]propanamide |
|---|---|
| PubChem CID | 125176210 |
| Molecular Formula | C18H28N4O3 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | N-[3-[[(2R)-2-hydroxy-3-pyrrolidin-1-ylpropyl]carbamoylamino]-4-methylphenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(C)c(NC(=O)NC[C@@H](O)CN2CCCC2)c1 |
| InChI | InChI=1S/C18H28N4O3/c1-3-17(24)20-14-7-6-13(2)16(10-14)21-18(25)19-11-15(23)12-22-8-4-5-9-22/h6-7,10,15,23H,3-5,8-9,11-12H2,1-2H3,(H,20,24)(H2,19,21,25)/t15-/m1/s1 |
| InChIKey | MFCLTRJMZFTNRA-OAHLLOKOSA-N |
| XLogP | 1.92 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |