C14H19Cl2N3O2 — CID 110923525
1-(2,5-dichlorophenyl)-3-(2-hydroxy-3-pyrrolidin-1-ylpropyl)urea (PubChem CID 110923525) has the molecular formula C14H19Cl2N3O2 and a molecular weight of 332.23 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-3-(2-hydroxy-3-pyrrolidin-1-ylpropyl)urea.
| Compound Name | 1-(2,5-dichlorophenyl)-3-(2-hydroxy-3-pyrrolidin-1-ylpropyl)urea |
|---|---|
| PubChem CID | 110923525 |
| Molecular Formula | C14H19Cl2N3O2 |
| Molecular Weight | 332.23 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-3-(2-hydroxy-3-pyrrolidin-1-ylpropyl)urea |
| SMILES | O=C(NCC(O)CN1CCCC1)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H19Cl2N3O2/c15-10-3-4-12(16)13(7-10)18-14(21)17-8-11(20)9-19-5-1-2-6-19/h3-4,7,11,20H,1-2,5-6,8-9H2,(H2,17,18,21) |
| InChIKey | RNVWDWDMQLOBER-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.23 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |