C17H27ClN4O2 — CID 44527624
1-(4-chlorophenyl)-3-[2-hydroxy-3-(4-propylpiperazin-1-yl)propyl]urea (PubChem CID 44527624) has the molecular formula C17H27ClN4O2 and a molecular weight of 354.88 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[2-hydroxy-3-(4-propylpiperazin-1-yl)propyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[2-hydroxy-3-(4-propylpiperazin-1-yl)propyl]urea |
|---|---|
| PubChem CID | 44527624 |
| Molecular Formula | C17H27ClN4O2 |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[2-hydroxy-3-(4-propylpiperazin-1-yl)propyl]urea |
| SMILES | CCCN1CCN(CC(O)CNC(=O)Nc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C17H27ClN4O2/c1-2-7-21-8-10-22(11-9-21)13-16(23)12-19-17(24)20-15-5-3-14(18)4-6-15/h3-6,16,23H,2,7-13H2,1H3,(H2,19,20,24) |
| InChIKey | LRXRNOZMFSGPEG-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |