C16H29N5O2 — CID 125167669
1-[(2R)-3-(azepan-1-yl)-2-hydroxypropyl]-3-(2-propylpyrazol-3-yl)urea (PubChem CID 125167669) has the molecular formula C16H29N5O2 and a molecular weight of 323.44 g/mol. Its IUPAC name is 1-[(2R)-3-(azepan-1-yl)-2-hydroxypropyl]-3-(2-propylpyrazol-3-yl)urea.
| Compound Name | 1-[(2R)-3-(azepan-1-yl)-2-hydroxypropyl]-3-(2-propylpyrazol-3-yl)urea |
|---|---|
| PubChem CID | 125167669 |
| Molecular Formula | C16H29N5O2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.23 |
| IUPAC Name | 1-[(2R)-3-(azepan-1-yl)-2-hydroxypropyl]-3-(2-propylpyrazol-3-yl)urea |
| SMILES | CCCn1nccc1NC(=O)NC[C@@H](O)CN1CCCCCC1 |
| InChI | InChI=1S/C16H29N5O2/c1-2-9-21-15(7-8-18-21)19-16(23)17-12-14(22)13-20-10-5-3-4-6-11-20/h7-8,14,22H,2-6,9-13H2,1H3,(H2,17,19,23)/t14-/m1/s1 |
| InChIKey | JREHOVBXYIXCDP-CQSZACIVSA-N |
| XLogP | 1.65 |
| TPSA | 82.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |