C12H22N4O3 — CID 124874562
1-[(2R)-1-hydroxy-4-methoxybutan-2-yl]-3-(2-propylpyrazol-3-yl)urea (PubChem CID 124874562) has the molecular formula C12H22N4O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is 1-[(2R)-1-hydroxy-4-methoxybutan-2-yl]-3-(2-propylpyrazol-3-yl)urea.
| Compound Name | 1-[(2R)-1-hydroxy-4-methoxybutan-2-yl]-3-(2-propylpyrazol-3-yl)urea |
|---|---|
| PubChem CID | 124874562 |
| Molecular Formula | C12H22N4O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 1-[(2R)-1-hydroxy-4-methoxybutan-2-yl]-3-(2-propylpyrazol-3-yl)urea |
| SMILES | CCCn1nccc1NC(=O)N[C@@H](CO)CCOC |
| InChI | InChI=1S/C12H22N4O3/c1-3-7-16-11(4-6-13-16)15-12(18)14-10(9-17)5-8-19-2/h4,6,10,17H,3,5,7-9H2,1-2H3,(H2,14,15,18)/t10-/m1/s1 |
| InChIKey | MGIBTCXVTPTYJI-SNVBAGLBSA-N |
| XLogP | 0.81 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |