C12H22N4O — CID 47420496
1-butyl-3-(2-butylpyrazol-3-yl)urea (PubChem CID 47420496) has the molecular formula C12H22N4O and a molecular weight of 238.33 g/mol. Its IUPAC name is 1-butyl-3-(2-butylpyrazol-3-yl)urea.
| Compound Name | 1-butyl-3-(2-butylpyrazol-3-yl)urea |
|---|---|
| PubChem CID | 47420496 |
| Molecular Formula | C12H22N4O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | 1-butyl-3-(2-butylpyrazol-3-yl)urea |
| SMILES | CCCCNC(=O)Nc1ccnn1CCCC |
| InChI | InChI=1S/C12H22N4O/c1-3-5-8-13-12(17)15-11-7-9-14-16(11)10-6-4-2/h7,9H,3-6,8,10H2,1-2H3,(H2,13,15,17) |
| InChIKey | ULASQAGRBMFIES-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|