C7H11FN4O — CID 130637088
1-(2-fluoroethyl)-3-(2-methylpyrazol-3-yl)urea (PubChem CID 130637088) has the molecular formula C7H11FN4O and a molecular weight of 186.19 g/mol. Its IUPAC name is 1-(2-fluoroethyl)-3-(2-methylpyrazol-3-yl)urea.
| Compound Name | 1-(2-fluoroethyl)-3-(2-methylpyrazol-3-yl)urea |
|---|---|
| PubChem CID | 130637088 |
| Molecular Formula | C7H11FN4O |
| Molecular Weight | 186.19 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 1-(2-fluoroethyl)-3-(2-methylpyrazol-3-yl)urea |
| SMILES | Cn1nccc1NC(=O)NCCF |
| InChI | InChI=1S/C7H11FN4O/c1-12-6(2-4-10-12)11-7(13)9-5-3-8/h2,4H,3,5H2,1H3,(H2,9,11,13) |
| InChIKey | ZYDLMUWAVRRXCR-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.19 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |