C16H22F3N3O2 — CID 111111295
1-[2-hydroxy-3-(4-methylpiperidin-1-yl)propyl]-3-(2,3,4-trifluorophenyl)urea (PubChem CID 111111295) has the molecular formula C16H22F3N3O2 and a molecular weight of 345.37 g/mol. Its IUPAC name is 1-[2-hydroxy-3-(4-methylpiperidin-1-yl)propyl]-3-(2,3,4-trifluorophenyl)urea.
| Compound Name | 1-[2-hydroxy-3-(4-methylpiperidin-1-yl)propyl]-3-(2,3,4-trifluorophenyl)urea |
|---|---|
| PubChem CID | 111111295 |
| Molecular Formula | C16H22F3N3O2 |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 1-[2-hydroxy-3-(4-methylpiperidin-1-yl)propyl]-3-(2,3,4-trifluorophenyl)urea |
| SMILES | CC1CCN(CC(O)CNC(=O)Nc2ccc(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C16H22F3N3O2/c1-10-4-6-22(7-5-10)9-11(23)8-20-16(24)21-13-3-2-12(17)14(18)15(13)19/h2-3,10-11,23H,4-9H2,1H3,(H2,20,21,24) |
| InChIKey | YUIKGJKHDYVFQL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|