C17H24ClFN2O2 — CID 111112760
2-(2-chloro-6-fluorophenyl)-N-[2-hydroxy-3-(4-methylpiperidin-1-yl)propyl]acetamide (PubChem CID 111112760) has the molecular formula C17H24ClFN2O2 and a molecular weight of 342.84 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-N-[2-hydroxy-3-(4-methylpiperidin-1-yl)propyl]acetamide.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-N-[2-hydroxy-3-(4-methylpiperidin-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 111112760 |
| Molecular Formula | C17H24ClFN2O2 |
| Molecular Weight | 342.84 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-N-[2-hydroxy-3-(4-methylpiperidin-1-yl)propyl]acetamide |
| SMILES | CC1CCN(CC(O)CNC(=O)Cc2c(F)cccc2Cl)CC1 |
| InChI | InChI=1S/C17H24ClFN2O2/c1-12-5-7-21(8-6-12)11-13(22)10-20-17(23)9-14-15(18)3-2-4-16(14)19/h2-4,12-13,22H,5-11H2,1H3,(H,20,23) |
| InChIKey | NBNSYWZPRZKWGU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.84 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |