C17H17ClFNO2 — CID 98622782
2-(2-chloro-6-fluorophenyl)-N-[(2R)-2-hydroxy-3-phenylpropyl]acetamide (PubChem CID 98622782) has the molecular formula C17H17ClFNO2 and a molecular weight of 321.78 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-N-[(2R)-2-hydroxy-3-phenylpropyl]acetamide.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-N-[(2R)-2-hydroxy-3-phenylpropyl]acetamide |
|---|---|
| PubChem CID | 98622782 |
| Molecular Formula | C17H17ClFNO2 |
| Molecular Weight | 321.78 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-N-[(2R)-2-hydroxy-3-phenylpropyl]acetamide |
| SMILES | O=C(Cc1c(F)cccc1Cl)NC[C@H](O)Cc1ccccc1 |
| InChI | InChI=1S/C17H17ClFNO2/c18-15-7-4-8-16(19)14(15)10-17(22)20-11-13(21)9-12-5-2-1-3-6-12/h1-8,13,21H,9-11H2,(H,20,22)/t13-/m1/s1 |
| InChIKey | FDIPTVMIVDDHIU-CYBMUJFWSA-N |
| XLogP | 2.74 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.78 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |