C15H21Cl2N3O2 — CID 111112860
3,6-dichloro-N-[2-hydroxy-3-(4-methylpiperidin-1-yl)propyl]pyridine-2-carboxamide (PubChem CID 111112860) has the molecular formula C15H21Cl2N3O2 and a molecular weight of 346.26 g/mol. Its IUPAC name is 3,6-dichloro-N-[2-hydroxy-3-(4-methylpiperidin-1-yl)propyl]pyridine-2-carboxamide.
| Compound Name | 3,6-dichloro-N-[2-hydroxy-3-(4-methylpiperidin-1-yl)propyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 111112860 |
| Molecular Formula | C15H21Cl2N3O2 |
| Molecular Weight | 346.26 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 3,6-dichloro-N-[2-hydroxy-3-(4-methylpiperidin-1-yl)propyl]pyridine-2-carboxamide |
| SMILES | CC1CCN(CC(O)CNC(=O)c2nc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C15H21Cl2N3O2/c1-10-4-6-20(7-5-10)9-11(21)8-18-15(22)14-12(16)2-3-13(17)19-14/h2-3,10-11,21H,4-9H2,1H3,(H,18,22) |
| InChIKey | RHHGYXSSMBHPNW-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|