C14H29N3O2 — CID 95617929
1-butyl-3-[(2R)-2-hydroxy-3-(4-methylpiperidin-1-yl)propyl]urea (PubChem CID 95617929) has the molecular formula C14H29N3O2 and a molecular weight of 271.40 g/mol. Its IUPAC name is 1-butyl-3-[(2R)-2-hydroxy-3-(4-methylpiperidin-1-yl)propyl]urea.
| Compound Name | 1-butyl-3-[(2R)-2-hydroxy-3-(4-methylpiperidin-1-yl)propyl]urea |
|---|---|
| PubChem CID | 95617929 |
| Molecular Formula | C14H29N3O2 |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | 1-butyl-3-[(2R)-2-hydroxy-3-(4-methylpiperidin-1-yl)propyl]urea |
| SMILES | CCCCNC(=O)NC[C@@H](O)CN1CCC(C)CC1 |
| InChI | InChI=1S/C14H29N3O2/c1-3-4-7-15-14(19)16-10-13(18)11-17-8-5-12(2)6-9-17/h12-13,18H,3-11H2,1-2H3,(H2,15,16,19)/t13-/m1/s1 |
| InChIKey | IQAFYFGAKVBZOW-CYBMUJFWSA-N |
| XLogP | 1.18 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|