C13H17ClF3NO2 — CID 81094009
2-chloro-N-(2,2-diethoxyethyl)-6-(trifluoromethyl)aniline (PubChem CID 81094009) has the molecular formula C13H17ClF3NO2 and a molecular weight of 311.73 g/mol. Its IUPAC name is 2-chloro-N-(2,2-diethoxyethyl)-6-(trifluoromethyl)aniline.
| Compound Name | 2-chloro-N-(2,2-diethoxyethyl)-6-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 81094009 |
| Molecular Formula | C13H17ClF3NO2 |
| Molecular Weight | 311.73 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 2-chloro-N-(2,2-diethoxyethyl)-6-(trifluoromethyl)aniline |
| SMILES | CCOC(CNc1c(Cl)cccc1C(F)(F)F)OCC |
| InChI | InChI=1S/C13H17ClF3NO2/c1-3-19-11(20-4-2)8-18-12-9(13(15,16)17)6-5-7-10(12)14/h5-7,11,18H,3-4,8H2,1-2H3 |
| InChIKey | XQKFCLUUEDANGO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.73 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|