C13H17ClF3N — CID 43121811
2-chloro-N-(2-methylpentyl)-6-(trifluoromethyl)aniline (PubChem CID 43121811) has the molecular formula C13H17ClF3N and a molecular weight of 279.73 g/mol. Its IUPAC name is 2-chloro-N-(2-methylpentyl)-6-(trifluoromethyl)aniline.
| Compound Name | 2-chloro-N-(2-methylpentyl)-6-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 43121811 |
| Molecular Formula | C13H17ClF3N |
| Molecular Weight | 279.73 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 2-chloro-N-(2-methylpentyl)-6-(trifluoromethyl)aniline |
| SMILES | CCCC(C)CNc1c(Cl)cccc1C(F)(F)F |
| InChI | InChI=1S/C13H17ClF3N/c1-3-5-9(2)8-18-12-10(13(15,16)17)6-4-7-11(12)14/h4,6-7,9,18H,3,5,8H2,1-2H3 |
| InChIKey | KZPNRYONVSWSNL-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.73 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |