C12H15ClF3NO2 — CID 63931718
1-[2-chloro-6-(trifluoromethyl)anilino]-3-ethoxypropan-2-ol (PubChem CID 63931718) has the molecular formula C12H15ClF3NO2 and a molecular weight of 297.70 g/mol. Its IUPAC name is 1-[2-chloro-6-(trifluoromethyl)anilino]-3-ethoxypropan-2-ol.
| Compound Name | 1-[2-chloro-6-(trifluoromethyl)anilino]-3-ethoxypropan-2-ol |
|---|---|
| PubChem CID | 63931718 |
| Molecular Formula | C12H15ClF3NO2 |
| Molecular Weight | 297.70 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 1-[2-chloro-6-(trifluoromethyl)anilino]-3-ethoxypropan-2-ol |
| SMILES | CCOCC(O)CNc1c(Cl)cccc1C(F)(F)F |
| InChI | InChI=1S/C12H15ClF3NO2/c1-2-19-7-8(18)6-17-11-9(12(14,15)16)4-3-5-10(11)13/h3-5,8,17-18H,2,6-7H2,1H3 |
| InChIKey | NTUWVSQUBJWPAV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.70 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |