C10H15Cl2N3O2 — CID 131886166
2,6-dichloro-N-(2,2-diethoxyethyl)pyrimidin-4-amine (PubChem CID 131886166) has the molecular formula C10H15Cl2N3O2 and a molecular weight of 280.15 g/mol. Its IUPAC name is 2,6-dichloro-N-(2,2-diethoxyethyl)pyrimidin-4-amine.
| Compound Name | 2,6-dichloro-N-(2,2-diethoxyethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 131886166 |
| Molecular Formula | C10H15Cl2N3O2 |
| Molecular Weight | 280.15 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 2,6-dichloro-N-(2,2-diethoxyethyl)pyrimidin-4-amine |
| SMILES | CCOC(CNc1cc(Cl)nc(Cl)n1)OCC |
| InChI | InChI=1S/C10H15Cl2N3O2/c1-3-16-9(17-4-2)6-13-8-5-7(11)14-10(12)15-8/h5,9H,3-4,6H2,1-2H3,(H,13,14,15) |
| InChIKey | AWEFVIFJPDOCJC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.15 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|