C16H19Cl2N3O2 — CID 88834197
6-chloro-2-(3-chlorophenyl)-N-(2,2-diethoxyethyl)pyrimidin-4-amine (PubChem CID 88834197) has the molecular formula C16H19Cl2N3O2 and a molecular weight of 356.25 g/mol. Its IUPAC name is 6-chloro-2-(3-chlorophenyl)-N-(2,2-diethoxyethyl)pyrimidin-4-amine.
| Compound Name | 6-chloro-2-(3-chlorophenyl)-N-(2,2-diethoxyethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 88834197 |
| Molecular Formula | C16H19Cl2N3O2 |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 6-chloro-2-(3-chlorophenyl)-N-(2,2-diethoxyethyl)pyrimidin-4-amine |
| SMILES | CCOC(CNc1cc(Cl)nc(-c2cccc(Cl)c2)n1)OCC |
| InChI | InChI=1S/C16H19Cl2N3O2/c1-3-22-15(23-4-2)10-19-14-9-13(18)20-16(21-14)11-6-5-7-12(17)8-11/h5-9,15H,3-4,10H2,1-2H3,(H,19,20,21) |
| InChIKey | LVXFAVFWJQEDLT-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|