C7H9Cl2N3O — CID 90456586
(2R)-1-[(2,6-dichloropyrimidin-4-yl)amino]propan-2-ol (PubChem CID 90456586) has the molecular formula C7H9Cl2N3O and a molecular weight of 222.07 g/mol. Its IUPAC name is (2R)-1-[(2,6-dichloropyrimidin-4-yl)amino]propan-2-ol.
| Compound Name | (2R)-1-[(2,6-dichloropyrimidin-4-yl)amino]propan-2-ol |
|---|---|
| PubChem CID | 90456586 |
| Molecular Formula | C7H9Cl2N3O |
| Molecular Weight | 222.07 g/mol |
| Exact Mass | 221.01 |
| IUPAC Name | (2R)-1-[(2,6-dichloropyrimidin-4-yl)amino]propan-2-ol |
| SMILES | C[C@@H](O)CNc1cc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C7H9Cl2N3O/c1-4(13)3-10-6-2-5(8)11-7(9)12-6/h2,4,13H,3H2,1H3,(H,10,11,12)/t4-/m1/s1 |
| InChIKey | ZVQKMUMKVHPVLC-SCSAIBSYSA-N |
| XLogP | 1.58 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.07 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |