C9H14ClN3S — CID 115756052
6-chloro-2-methyl-N-(2-methylsulfanylpropyl)pyrimidin-4-amine (PubChem CID 115756052) has the molecular formula C9H14ClN3S and a molecular weight of 231.75 g/mol. Its IUPAC name is 6-chloro-2-methyl-N-(2-methylsulfanylpropyl)pyrimidin-4-amine.
| Compound Name | 6-chloro-2-methyl-N-(2-methylsulfanylpropyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 115756052 |
| Molecular Formula | C9H14ClN3S |
| Molecular Weight | 231.75 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 6-chloro-2-methyl-N-(2-methylsulfanylpropyl)pyrimidin-4-amine |
| SMILES | CSC(C)CNc1cc(Cl)nc(C)n1 |
| InChI | InChI=1S/C9H14ClN3S/c1-6(14-3)5-11-9-4-8(10)12-7(2)13-9/h4,6H,5H2,1-3H3,(H,11,12,13) |
| InChIKey | NUXUISZIBZZKLM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.75 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |