C9H13Cl2N3O — CID 130570519
4-[(2,6-dichloropyrimidin-4-yl)amino]-2-methylbutan-2-ol (PubChem CID 130570519) has the molecular formula C9H13Cl2N3O and a molecular weight of 250.13 g/mol. Its IUPAC name is 4-[(2,6-dichloropyrimidin-4-yl)amino]-2-methylbutan-2-ol.
| Compound Name | 4-[(2,6-dichloropyrimidin-4-yl)amino]-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 130570519 |
| Molecular Formula | C9H13Cl2N3O |
| Molecular Weight | 250.13 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | 4-[(2,6-dichloropyrimidin-4-yl)amino]-2-methylbutan-2-ol |
| SMILES | CC(C)(O)CCNc1cc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C9H13Cl2N3O/c1-9(2,15)3-4-12-7-5-6(10)13-8(11)14-7/h5,15H,3-4H2,1-2H3,(H,12,13,14) |
| InChIKey | QLJFNGPKVXKMEJ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.13 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |