C8H11Cl2N3O3S — CID 142795094
3-[(2,6-dichloropyrimidin-4-yl)amino]propyl methanesulfonate (PubChem CID 142795094) has the molecular formula C8H11Cl2N3O3S and a molecular weight of 300.17 g/mol. Its IUPAC name is 3-[(2,6-dichloropyrimidin-4-yl)amino]propyl methanesulfonate.
| Compound Name | 3-[(2,6-dichloropyrimidin-4-yl)amino]propyl methanesulfonate |
|---|---|
| PubChem CID | 142795094 |
| Molecular Formula | C8H11Cl2N3O3S |
| Molecular Weight | 300.17 g/mol |
| Exact Mass | 298.99 |
| IUPAC Name | 3-[(2,6-dichloropyrimidin-4-yl)amino]propyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCCNc1cc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C8H11Cl2N3O3S/c1-17(14,15)16-4-2-3-11-7-5-6(9)12-8(10)13-7/h5H,2-4H2,1H3,(H,11,12,13) |
| InChIKey | NECIGPRONDEIJG-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.17 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|